C15H21NO6 — CID 131859449
methyl 2-amino-2-(3,4,5-trimethoxybenzoyl)butanoate (PubChem CID 131859449) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is methyl 2-amino-2-(3,4,5-trimethoxybenzoyl)butanoate.
| Compound Name | methyl 2-amino-2-(3,4,5-trimethoxybenzoyl)butanoate |
|---|---|
| PubChem CID | 131859449 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | methyl 2-amino-2-(3,4,5-trimethoxybenzoyl)butanoate |
| SMILES | CCC(N)(C(=O)OC)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21NO6/c1-6-15(16,14(18)22-5)13(17)9-7-10(19-2)12(21-4)11(8-9)20-3/h7-8H,6,16H2,1-5H3 |
| InChIKey | SWEMXWOQMNMZEP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|