C15H20N2O4 — CID 51089527
N-(2-cyanobutan-2-yl)-3,4,5-trimethoxybenzamide (PubChem CID 51089527) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2-cyanobutan-2-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 51089527 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-3,4,5-trimethoxybenzamide |
| SMILES | CCC(C)(C#N)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-6-15(2,9-16)17-14(18)10-7-11(19-3)13(21-5)12(8-10)20-4/h7-8H,6H2,1-5H3,(H,17,18) |
| InChIKey | CTLCWCZLEISMBX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |