C16H21NO4 — CID 709973
3,4,5-trimethoxy-N-[(3S)-3-methylpent-1-yn-3-yl]benzamide (PubChem CID 709973) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(3S)-3-methylpent-1-yn-3-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(3S)-3-methylpent-1-yn-3-yl]benzamide |
|---|---|
| PubChem CID | 709973 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(3S)-3-methylpent-1-yn-3-yl]benzamide |
| SMILES | C#C[C@](C)(CC)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H21NO4/c1-7-16(3,8-2)17-15(18)11-9-12(19-4)14(21-6)13(10-11)20-5/h1,9-10H,8H2,2-6H3,(H,17,18)/t16-/m1/s1 |
| InChIKey | ITWPFMVALYGYGM-MRXNPFEDSA-N |
| XLogP | 2.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|