C10H13NO4S — CID 59695341
3,4,5-trimethoxy-N-sulfanylbenzamide (PubChem CID 59695341) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-sulfanylbenzamide.
| Compound Name | 3,4,5-trimethoxy-N-sulfanylbenzamide |
|---|---|
| PubChem CID | 59695341 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3,4,5-trimethoxy-N-sulfanylbenzamide |
| SMILES | COc1cc(C(=O)NS)cc(OC)c1OC |
| InChI | InChI=1S/C10H13NO4S/c1-13-7-4-6(10(12)11-16)5-8(14-2)9(7)15-3/h4-5,16H,1-3H3,(H,11,12) |
| InChIKey | VXAXHSWPKCIORE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|