C9H11NO3S — CID 71771275
3,4-dimethoxy-N-sulfanylbenzamide (PubChem CID 71771275) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 3,4-dimethoxy-N-sulfanylbenzamide.
| Compound Name | 3,4-dimethoxy-N-sulfanylbenzamide |
|---|---|
| PubChem CID | 71771275 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 3,4-dimethoxy-N-sulfanylbenzamide |
| SMILES | COc1ccc(C(=O)NS)cc1OC |
| InChI | InChI=1S/C9H11NO3S/c1-12-7-4-3-6(9(11)10-14)5-8(7)13-2/h3-5,14H,1-2H3,(H,10,11) |
| InChIKey | YKMVYMPFQATKOU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|