C17H14N2O5 — CID 4923492
N-(1,3-dioxoisoindol-2-yl)-3,4-dimethoxybenzamide (PubChem CID 4923492) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-2-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(1,3-dioxoisoindol-2-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4923492 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(1,3-dioxoisoindol-2-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C17H14N2O5/c1-23-13-8-7-10(9-14(13)24-2)15(20)18-19-16(21)11-5-3-4-6-12(11)17(19)22/h3-9H,1-2H3,(H,18,20) |
| InChIKey | LHICILRFYKWYIM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|