C29H25N3O6 — CID 142665259
2-(3-cyclopentyloxy-4-methoxyphenyl)-N-(1,3-dioxoisoindol-2-yl)-3-oxo-1H-isoindole-5-carboxamide (PubChem CID 142665259) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-methoxyphenyl)-N-(1,3-dioxoisoindol-2-yl)-3-oxo-1H-isoindole-5-carboxamide.
| Compound Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-N-(1,3-dioxoisoindol-2-yl)-3-oxo-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 142665259 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-N-(1,3-dioxoisoindol-2-yl)-3-oxo-1H-isoindole-5-carboxamide |
| SMILES | COc1ccc(N2Cc3ccc(C(=O)NN4C(=O)c5ccccc5C4=O)cc3C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H25N3O6/c1-37-24-13-12-19(15-25(24)38-20-6-2-3-7-20)31-16-18-11-10-17(14-23(18)27(31)34)26(33)30-32-28(35)21-8-4-5-9-22(21)29(32)36/h4-5,8-15,20H,2-3,6-7,16H2,1H3,(H,30,33) |
| InChIKey | SHQRZDZHDSYQSF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|