C28H23N3O6 — CID 142665297
2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-5-carbonyl]pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 142665297) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-5-carbonyl]pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-5-carbonyl]pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 142665297 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-3-oxo-1H-isoindole-5-carbonyl]pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | COc1ccc(N2Cc3ccc(C(=O)N4C(=O)c5ccncc5C4=O)cc3C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C28H23N3O6/c1-36-23-9-8-18(13-24(23)37-19-4-2-3-5-19)30-15-17-7-6-16(12-21(17)26(30)33)25(32)31-27(34)20-10-11-29-14-22(20)28(31)35/h6-14,19H,2-5,15H2,1H3 |
| InChIKey | VVBWQDSPDOPPDU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 106.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|