C20H19NO3S — CID 90596857
3,4-dimethoxy-N-[(2-thiophen-3-ylphenyl)methyl]benzamide (PubChem CID 90596857) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(2-thiophen-3-ylphenyl)methyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(2-thiophen-3-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 90596857 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3,4-dimethoxy-N-[(2-thiophen-3-ylphenyl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2ccccc2-c2ccsc2)cc1OC |
| InChI | InChI=1S/C20H19NO3S/c1-23-18-8-7-14(11-19(18)24-2)20(22)21-12-15-5-3-4-6-17(15)16-9-10-25-13-16/h3-11,13H,12H2,1-2H3,(H,21,22) |
| InChIKey | TXPZAXZGZWMIQC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |