C21H21NOS — CID 90596839
2,4,6-trimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzamide (PubChem CID 90596839) has the molecular formula C21H21NOS and a molecular weight of 335.47 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzamide.
| Compound Name | 2,4,6-trimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 90596839 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2,4,6-trimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NCc2ccccc2-c2ccsc2)c(C)c1 |
| InChI | InChI=1S/C21H21NOS/c1-14-10-15(2)20(16(3)11-14)21(23)22-12-17-6-4-5-7-19(17)18-8-9-24-13-18/h4-11,13H,12H2,1-3H3,(H,22,23) |
| InChIKey | BMYZCAJRMDRALH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |