C19H16ClNOS — CID 90596848
2-(4-chlorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]acetamide (PubChem CID 90596848) has the molecular formula C19H16ClNOS and a molecular weight of 341.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 90596848 |
| Molecular Formula | C19H16ClNOS |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCc1ccccc1-c1ccsc1 |
| InChI | InChI=1S/C19H16ClNOS/c20-17-7-5-14(6-8-17)11-19(22)21-12-15-3-1-2-4-18(15)16-9-10-23-13-16/h1-10,13H,11-12H2,(H,21,22) |
| InChIKey | NWZNFSZUEBZGHE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |