C19H17FN2O3S2 — CID 90596889
2-[(2-fluorophenyl)sulfonylamino]-N-[(2-thiophen-3-ylphenyl)methyl]acetamide (PubChem CID 90596889) has the molecular formula C19H17FN2O3S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-N-[(2-thiophen-3-ylphenyl)methyl]acetamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-N-[(2-thiophen-3-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 90596889 |
| Molecular Formula | C19H17FN2O3S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-N-[(2-thiophen-3-ylphenyl)methyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1F)NCc1ccccc1-c1ccsc1 |
| InChI | InChI=1S/C19H17FN2O3S2/c20-17-7-3-4-8-18(17)27(24,25)22-12-19(23)21-11-14-5-1-2-6-16(14)15-9-10-26-13-15/h1-10,13,22H,11-12H2,(H,21,23) |
| InChIKey | DOWNUPCURFLEON-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |