C20H19NOS — CID 90596831
3-phenyl-N-[(2-thiophen-3-ylphenyl)methyl]propanamide (PubChem CID 90596831) has the molecular formula C20H19NOS and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-phenyl-N-[(2-thiophen-3-ylphenyl)methyl]propanamide.
| Compound Name | 3-phenyl-N-[(2-thiophen-3-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 90596831 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-phenyl-N-[(2-thiophen-3-ylphenyl)methyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NCc1ccccc1-c1ccsc1 |
| InChI | InChI=1S/C20H19NOS/c22-20(11-10-16-6-2-1-3-7-16)21-14-17-8-4-5-9-19(17)18-12-13-23-15-18/h1-9,12-13,15H,10-11,14H2,(H,21,22) |
| InChIKey | YSPAGXFCMMEMCV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |