C24H18FNOS — CID 90596881
4-(4-fluorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]benzamide (PubChem CID 90596881) has the molecular formula C24H18FNOS and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]benzamide.
| Compound Name | 4-(4-fluorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 90596881 |
| Molecular Formula | C24H18FNOS |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(2-thiophen-3-ylphenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1-c1ccsc1)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H18FNOS/c25-22-11-9-18(10-12-22)17-5-7-19(8-6-17)24(27)26-15-20-3-1-2-4-23(20)21-13-14-28-16-21/h1-14,16H,15H2,(H,26,27) |
| InChIKey | RQFNIGRVRDEAHV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |