C18H15ClN2OS — CID 71809975
1-(2-chlorophenyl)-3-[(2-thiophen-3-ylphenyl)methyl]urea (PubChem CID 71809975) has the molecular formula C18H15ClN2OS and a molecular weight of 342.85 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(2-thiophen-3-ylphenyl)methyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(2-thiophen-3-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 71809975 |
| Molecular Formula | C18H15ClN2OS |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(2-thiophen-3-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccccc1-c1ccsc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H15ClN2OS/c19-16-7-3-4-8-17(16)21-18(22)20-11-13-5-1-2-6-15(13)14-9-10-23-12-14/h1-10,12H,11H2,(H2,20,21,22) |
| InChIKey | RDVBTDPHTYQRAY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |