C14H11NOS — CID 90596997
N-[(2-thiophen-3-ylphenyl)methyl]prop-2-ynamide (PubChem CID 90596997) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is N-[(2-thiophen-3-ylphenyl)methyl]prop-2-ynamide.
| Compound Name | N-[(2-thiophen-3-ylphenyl)methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 90596997 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-[(2-thiophen-3-ylphenyl)methyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCc1ccccc1-c1ccsc1 |
| InChI | InChI=1S/C14H11NOS/c1-2-14(16)15-9-11-5-3-4-6-13(11)12-7-8-17-10-12/h1,3-8,10H,9H2,(H,15,16) |
| InChIKey | GSEXGOWSPJAFNS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|