C18H16FNO2S2 — CID 71809982
4-fluoro-3-methyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide (PubChem CID 71809982) has the molecular formula C18H16FNO2S2 and a molecular weight of 361.46 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71809982 |
| Molecular Formula | C18H16FNO2S2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-fluoro-3-methyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2ccccc2-c2ccsc2)ccc1F |
| InChI | InChI=1S/C18H16FNO2S2/c1-13-10-16(6-7-18(13)19)24(21,22)20-11-14-4-2-3-5-17(14)15-8-9-23-12-15/h2-10,12,20H,11H2,1H3 |
| InChIKey | PUOBNBDLGFVIIU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |