C24H21NO3S2 — CID 90597144
4-(2-methylphenoxy)-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide (PubChem CID 90597144) has the molecular formula C24H21NO3S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-(2-methylphenoxy)-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90597144 |
| Molecular Formula | C24H21NO3S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-(2-methylphenoxy)-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccccc1Oc1ccc(S(=O)(=O)NCc2ccccc2-c2ccsc2)cc1 |
| InChI | InChI=1S/C24H21NO3S2/c1-18-6-2-5-9-24(18)28-21-10-12-22(13-11-21)30(26,27)25-16-19-7-3-4-8-23(19)20-14-15-29-17-20/h2-15,17,25H,16H2,1H3 |
| InChIKey | ONFJIVTZBPDPNM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |