C22H17ClN2O3S2 — CID 121166043
4-(2-chlorophenoxy)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide (PubChem CID 121166043) has the molecular formula C22H17ClN2O3S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121166043 |
| Molecular Formula | C22H17ClN2O3S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(-c2ccsc2)c1)c1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2O3S2/c23-20-3-1-2-4-22(20)28-18-5-7-19(8-6-18)30(26,27)25-14-16-9-11-24-21(13-16)17-10-12-29-15-17/h1-13,15,25H,14H2 |
| InChIKey | LLHGCCAPDFBTLF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |