C16H15N3O4S3 — CID 121166056
4-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzene-1,4-disulfonamide (PubChem CID 121166056) has the molecular formula C16H15N3O4S3 and a molecular weight of 409.51 g/mol. Its IUPAC name is 4-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 121166056 |
| Molecular Formula | C16H15N3O4S3 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 4-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NCc2ccnc(-c3ccsc3)c2)cc1 |
| InChI | InChI=1S/C16H15N3O4S3/c17-25(20,21)14-1-3-15(4-2-14)26(22,23)19-10-12-5-7-18-16(9-12)13-6-8-24-11-13/h1-9,11,19H,10H2,(H2,17,20,21) |
| InChIKey | QAHQBPXJCULGGM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |