C14H14N4O2S2 — CID 91625719
1-methyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]pyrazole-4-sulfonamide (PubChem CID 91625719) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-methyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 91625719 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-methyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCc2ccnc(-c3ccsc3)c2)cn1 |
| InChI | InChI=1S/C14H14N4O2S2/c1-18-9-13(8-16-18)22(19,20)17-7-11-2-4-15-14(6-11)12-3-5-21-10-12/h2-6,8-10,17H,7H2,1H3 |
| InChIKey | WWPZGDQPJZQYNU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |