C16H14N2O2S2 — CID 121165981
N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide (PubChem CID 121165981) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121165981 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(-c2ccsc2)c1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2S2/c19-22(20,15-4-2-1-3-5-15)18-11-13-6-8-17-16(10-13)14-7-9-21-12-14/h1-10,12,18H,11H2 |
| InChIKey | UDBYBABECBMRKH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |