C26H20N2O2S — CID 90137222
4-(2-phenylethynyl)-N-[(2-phenyl-4-pyridinyl)methyl]benzenesulfonamide (PubChem CID 90137222) has the molecular formula C26H20N2O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 4-(2-phenylethynyl)-N-[(2-phenyl-4-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 4-(2-phenylethynyl)-N-[(2-phenyl-4-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90137222 |
| Molecular Formula | C26H20N2O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-(2-phenylethynyl)-N-[(2-phenyl-4-pyridinyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(-c2ccccc2)c1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N2O2S/c29-31(30,25-15-13-22(14-16-25)12-11-21-7-3-1-4-8-21)28-20-23-17-18-27-26(19-23)24-9-5-2-6-10-24/h1-10,13-19,28H,20H2 |
| InChIKey | BQGVYOLSSFISPI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|