C23H26N4O2S — CID 55873999
N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-phenylbenzenesulfonamide (PubChem CID 55873999) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 55873999 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-phenylbenzenesulfonamide |
| SMILES | CN1CCN(c2cc(CNS(=O)(=O)c3ccc(-c4ccccc4)cc3)ccn2)CC1 |
| InChI | InChI=1S/C23H26N4O2S/c1-26-13-15-27(16-14-26)23-17-19(11-12-24-23)18-25-30(28,29)22-9-7-21(8-10-22)20-5-3-2-4-6-20/h2-12,17,25H,13-16,18H2,1H3 |
| InChIKey | FYDWUMUMHMEAIT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |