C16H19ClN4O2S — CID 55874135
6-chloro-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]pyridine-3-sulfonamide (PubChem CID 55874135) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is 6-chloro-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55874135 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 6-chloro-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(N2CCCCC2)c1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H19ClN4O2S/c17-15-5-4-14(12-19-15)24(22,23)20-11-13-6-7-18-16(10-13)21-8-2-1-3-9-21/h4-7,10,12,20H,1-3,8-9,11H2 |
| InChIKey | MMLGNEBADONJPB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|