C19H22F3N3O2S — CID 75420088
N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 75420088) has the molecular formula C19H22F3N3O2S and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 75420088 |
| Molecular Formula | C19H22F3N3O2S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(N2CCCCCC2)c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H22F3N3O2S/c20-19(21,22)16-7-3-4-8-17(16)28(26,27)24-14-15-9-10-23-18(13-15)25-11-5-1-2-6-12-25/h3-4,7-10,13,24H,1-2,5-6,11-12,14H2 |
| InChIKey | OTIDQWSPGLPDEP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |