C17H28N6O — CID 155944201
4-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboxamide (PubChem CID 155944201) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 155944201 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 4-methyl-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)NCc2ccnc(N3CCN(C)CC3)c2)CC1 |
| InChI | InChI=1S/C17H28N6O/c1-20-5-9-22(10-6-20)16-13-15(3-4-18-16)14-19-17(24)23-11-7-21(2)8-12-23/h3-4,13H,5-12,14H2,1-2H3,(H,19,24) |
| InChIKey | QAUOHABZVNQJSE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 54.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |