C23H37N5O — CID 86882069
N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-azaspiro[5.5]undecane-3-carboxamide (PubChem CID 86882069) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-azaspiro[5.5]undecane-3-carboxamide.
| Compound Name | N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-azaspiro[5.5]undecane-3-carboxamide |
|---|---|
| PubChem CID | 86882069 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-3-azaspiro[5.5]undecane-3-carboxamide |
| SMILES | CCN1CCN(c2cc(CNC(=O)N3CCC4(CCCCC4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C23H37N5O/c1-2-26-14-16-27(17-15-26)21-18-20(6-11-24-21)19-25-22(29)28-12-9-23(10-13-28)7-4-3-5-8-23/h6,11,18H,2-5,7-10,12-17,19H2,1H3,(H,25,29) |
| InChIKey | YSXDSUXDUNCMSF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |