C24H39N5O — CID 55793525
4-(azepan-1-ylmethyl)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-carboxamide (PubChem CID 55793525) has the molecular formula C24H39N5O and a molecular weight of 413.61 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-(azepan-1-ylmethyl)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 55793525 |
| Molecular Formula | C24H39N5O |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccnc(N2CCCCC2)c1)N1CCC(CN2CCCCCC2)CC1 |
| InChI | InChI=1S/C24H39N5O/c30-24(26-19-22-8-11-25-23(18-22)28-14-6-3-7-15-28)29-16-9-21(10-17-29)20-27-12-4-1-2-5-13-27/h8,11,18,21H,1-7,9-10,12-17,19-20H2,(H,26,30) |
| InChIKey | RFQPVDCMYOHEJL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |