C23H37N5O2 — CID 86898946
N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide (PubChem CID 86898946) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide.
| Compound Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86898946 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-4-(morpholin-4-ylmethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccnc(N2CCCCCC2)c1)N1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C23H37N5O2/c29-23(28-11-6-20(7-12-28)19-26-13-15-30-16-14-26)25-18-21-5-8-24-22(17-21)27-9-3-1-2-4-10-27/h5,8,17,20H,1-4,6-7,9-16,18-19H2,(H,25,29) |
| InChIKey | BRDURCOGQIGYKA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |