C24H40N6O3 — CID 55794635
4-N-[3-(diethylamino)propyl]-1-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 55794635) has the molecular formula C24H40N6O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 4-N-[3-(diethylamino)propyl]-1-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[3-(diethylamino)propyl]-1-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55794635 |
| Molecular Formula | C24H40N6O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 4-N-[3-(diethylamino)propyl]-1-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)CCCNC(=O)C1CCN(C(=O)NCc2ccnc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C24H40N6O3/c1-3-28(4-2)11-5-9-26-23(31)21-7-12-30(13-8-21)24(32)27-19-20-6-10-25-22(18-20)29-14-16-33-17-15-29/h6,10,18,21H,3-5,7-9,11-17,19H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | KNJCEBDUURDTDX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|