C25H40N4O2 — CID 55769235
4-(azepan-1-ylmethyl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 55769235) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 4-(azepan-1-ylmethyl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 55769235 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1CN1CCOCC1)N1CCC(CN2CCCCCC2)CC1 |
| InChI | InChI=1S/C25H40N4O2/c30-25(29-13-9-22(10-14-29)20-27-11-5-1-2-6-12-27)26-19-23-7-3-4-8-24(23)21-28-15-17-31-18-16-28/h3-4,7-8,22H,1-2,5-6,9-21H2,(H,26,30) |
| InChIKey | NMHUJAZZTUZHSZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |