C17H28N4O — CID 49172277
N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide (PubChem CID 49172277) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide.
| Compound Name | N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide |
|---|---|
| PubChem CID | 49172277 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1ccnc(N2CCN(CC)CC2)c1 |
| InChI | InChI=1S/C17H28N4O/c1-3-5-6-17(22)19-14-15-7-8-18-16(13-15)21-11-9-20(4-2)10-12-21/h7-8,13H,3-6,9-12,14H2,1-2H3,(H,19,22) |
| InChIKey | MJHSTBOSVKWZGU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |