C23H32N4O2 — CID 55911750
N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(2-phenylethoxy)butanamide (PubChem CID 55911750) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(2-phenylethoxy)butanamide.
| Compound Name | N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(2-phenylethoxy)butanamide |
|---|---|
| PubChem CID | 55911750 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(2-phenylethoxy)butanamide |
| SMILES | CN1CCN(c2cc(CNC(=O)CCCOCCc3ccccc3)ccn2)CC1 |
| InChI | InChI=1S/C23H32N4O2/c1-26-12-14-27(15-13-26)22-18-21(9-11-24-22)19-25-23(28)8-5-16-29-17-10-20-6-3-2-4-7-20/h2-4,6-7,9,11,18H,5,8,10,12-17,19H2,1H3,(H,25,28) |
| InChIKey | PQDIMOSLKULTQS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|