C24H34N4O2 — CID 47925567
5-(2,5-dimethylphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide (PubChem CID 47925567) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide |
|---|---|
| PubChem CID | 47925567 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)NCc2ccnc(N3CCN(C)CC3)c2)c1 |
| InChI | InChI=1S/C24H34N4O2/c1-19-7-8-20(2)22(16-19)30-15-5-4-6-24(29)26-18-21-9-10-25-23(17-21)28-13-11-27(3)12-14-28/h7-10,16-17H,4-6,11-15,18H2,1-3H3,(H,26,29) |
| InChIKey | ZKIJSTKEWTZDIQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|