C23H26N4O4 — CID 32586251
4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide (PubChem CID 32586251) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide.
| Compound Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 32586251 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)NCc1ccnc(N3CCOCC3)c1)C2=O |
| InChI | InChI=1S/C23H26N4O4/c1-16-4-5-18-19(13-16)23(30)27(22(18)29)8-2-3-21(28)25-15-17-6-7-24-20(14-17)26-9-11-31-12-10-26/h4-7,13-14H,2-3,8-12,15H2,1H3,(H,25,28) |
| InChIKey | XCGSYMINGGQARB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|