C20H23Cl2N3O3 — CID 32585405
4-(2,4-dichlorophenoxy)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide (PubChem CID 32585405) has the molecular formula C20H23Cl2N3O3 and a molecular weight of 424.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 32585405 |
| Molecular Formula | C20H23Cl2N3O3 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCc1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H23Cl2N3O3/c21-16-3-4-18(17(22)13-16)28-9-1-2-20(26)24-14-15-5-6-23-19(12-15)25-7-10-27-11-8-25/h3-6,12-13H,1-2,7-11,14H2,(H,24,26) |
| InChIKey | OIFUUEWWYYOUNT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|