C20H33N5O2 — CID 53186075
N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-(2-morpholin-4-yl-4-pyridinyl)propanamide (PubChem CID 53186075) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-(2-morpholin-4-yl-4-pyridinyl)propanamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-(2-morpholin-4-yl-4-pyridinyl)propanamide |
|---|---|
| PubChem CID | 53186075 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-3-(2-morpholin-4-yl-4-pyridinyl)propanamide |
| SMILES | CCN1CCN(CCNC(=O)CCc2ccnc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H33N5O2/c1-2-23-9-11-24(12-10-23)8-7-22-20(26)4-3-18-5-6-21-19(17-18)25-13-15-27-16-14-25/h5-6,17H,2-4,7-16H2,1H3,(H,22,26) |
| InChIKey | KKKZOBRMLHINOU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |