C16H13BrN2O2S2 — CID 121166054
4-bromo-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide (PubChem CID 121166054) has the molecular formula C16H13BrN2O2S2 and a molecular weight of 409.33 g/mol. Its IUPAC name is 4-bromo-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121166054 |
| Molecular Formula | C16H13BrN2O2S2 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 4-bromo-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccnc(-c2ccsc2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrN2O2S2/c17-14-1-3-15(4-2-14)23(20,21)19-10-12-5-7-18-16(9-12)13-6-8-22-11-13/h1-9,11,19H,10H2 |
| InChIKey | IETAPJOSRVBTLR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |