C19H19NO2S2 — CID 90597078
3,4-dimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide (PubChem CID 90597078) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90597078 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3,4-dimethyl-N-[(2-thiophen-3-ylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2-c2ccsc2)cc1C |
| InChI | InChI=1S/C19H19NO2S2/c1-14-7-8-18(11-15(14)2)24(21,22)20-12-16-5-3-4-6-19(16)17-9-10-23-13-17/h3-11,13,20H,12H2,1-2H3 |
| InChIKey | XHIDMQHNEAAIEN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |