C17H17N3O5S — CID 66907731
N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(2-methylphenoxy)benzenesulfonamide (PubChem CID 66907731) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(2-methylphenoxy)benzenesulfonamide.
| Compound Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(2-methylphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 66907731 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(2-methylphenoxy)benzenesulfonamide |
| SMILES | Cc1ccccc1Oc1ccc(S(=O)(=O)NCC2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H17N3O5S/c1-11-4-2-3-5-15(11)25-12-6-8-13(9-7-12)26(23,24)18-10-14-16(21)20-17(22)19-14/h2-9,14,18H,10H2,1H3,(H2,19,20,21,22) |
| InChIKey | AJQCWSVPWOHYQD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|