C17H17N3O6S — CID 59710560
N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-4-(2-methoxyphenoxy)benzenesulfonamide (PubChem CID 59710560) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-4-(2-methoxyphenoxy)benzenesulfonamide.
| Compound Name | N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-4-(2-methoxyphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 59710560 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-4-(2-methoxyphenoxy)benzenesulfonamide |
| SMILES | COc1ccccc1Oc1ccc(S(=O)(=O)NC[C@@H]2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H17N3O6S/c1-25-14-4-2-3-5-15(14)26-11-6-8-12(9-7-11)27(23,24)18-10-13-16(21)20-17(22)19-13/h2-9,13,18H,10H2,1H3,(H2,19,20,21,22)/t13-/m0/s1 |
| InChIKey | KOJHPRSCMLZNOY-ZDUSSCGKSA-N |
| XLogP | 0.97 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|