C16H15ClN3O5S+ — CID 142170734
4-(2-chlorophenoxy)-N-[[(4S)-2,5-dioxoimidazolidin-3-ium-4-yl]methyl]benzenesulfonamide (PubChem CID 142170734) has the molecular formula C16H15ClN3O5S+ and a molecular weight of 396.83 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[[(4S)-2,5-dioxoimidazolidin-3-ium-4-yl]methyl]benzenesulfonamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[[(4S)-2,5-dioxoimidazolidin-3-ium-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142170734 |
| Molecular Formula | C16H15ClN3O5S+ |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[[(4S)-2,5-dioxoimidazolidin-3-ium-4-yl]methyl]benzenesulfonamide |
| SMILES | O=C1NC(=O)[C@H](CNS(=O)(=O)c2ccc(Oc3ccccc3Cl)cc2)[NH2+]1 |
| InChI | InChI=1S/C16H14ClN3O5S/c17-12-3-1-2-4-14(12)25-10-5-7-11(8-6-10)26(23,24)18-9-13-15(21)20-16(22)19-13/h1-8,13,18H,9H2,(H2,19,20,21,22)/p+1/t13-/m0/s1 |
| InChIKey | VQWHLVMEHAQXQG-ZDUSSCGKSA-O |
| XLogP | 0.59 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|