C17H14F3N3O5S — CID 66908054
N-[(2,5-dioxoimidazolidin-4-yl)methyl]-3-[4-(trifluoromethyl)phenoxy]benzenesulfonamide (PubChem CID 66908054) has the molecular formula C17H14F3N3O5S and a molecular weight of 429.38 g/mol. Its IUPAC name is N-[(2,5-dioxoimidazolidin-4-yl)methyl]-3-[4-(trifluoromethyl)phenoxy]benzenesulfonamide.
| Compound Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-3-[4-(trifluoromethyl)phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 66908054 |
| Molecular Formula | C17H14F3N3O5S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-3-[4-(trifluoromethyl)phenoxy]benzenesulfonamide |
| SMILES | O=C1NC(=O)C(CNS(=O)(=O)c2cccc(Oc3ccc(C(F)(F)F)cc3)c2)N1 |
| InChI | InChI=1S/C17H14F3N3O5S/c18-17(19,20)10-4-6-11(7-5-10)28-12-2-1-3-13(8-12)29(26,27)21-9-14-15(24)23-16(25)22-14/h1-8,14,21H,9H2,(H2,22,23,24,25) |
| InChIKey | JRSZOETZMGUNJS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|