C18H16F3N3O5S — CID 59710562
N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-N-methyl-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide (PubChem CID 59710562) has the molecular formula C18H16F3N3O5S and a molecular weight of 443.40 g/mol. Its IUPAC name is N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-N-methyl-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide.
| Compound Name | N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-N-methyl-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 59710562 |
| Molecular Formula | C18H16F3N3O5S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-[[(4S)-2,5-dioxoimidazolidin-4-yl]methyl]-N-methyl-4-[4-(trifluoromethyl)phenoxy]benzenesulfonamide |
| SMILES | CN(C[C@@H]1NC(=O)NC1=O)S(=O)(=O)c1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F3N3O5S/c1-24(10-15-16(25)23-17(26)22-15)30(27,28)14-8-6-13(7-9-14)29-12-4-2-11(3-5-12)18(19,20)21/h2-9,15H,10H2,1H3,(H2,22,23,25,26)/t15-/m0/s1 |
| InChIKey | AADVDOFRPDZACN-HNNXBMFYSA-N |
| XLogP | 2.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|