C20H29F3N2O2S — CID 22310802
N-methyl-N-[[4-[[methyl(prop-2-enyl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 22310802) has the molecular formula C20H29F3N2O2S and a molecular weight of 418.53 g/mol. Its IUPAC name is N-methyl-N-[[4-[[methyl(prop-2-enyl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-methyl-N-[[4-[[methyl(prop-2-enyl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22310802 |
| Molecular Formula | C20H29F3N2O2S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-methyl-N-[[4-[[methyl(prop-2-enyl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(C)CC1CCC(CN(C)S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H29F3N2O2S/c1-4-13-24(2)14-16-5-7-17(8-6-16)15-25(3)28(26,27)19-11-9-18(10-12-19)20(21,22)23/h4,9-12,16-17H,1,5-8,13-15H2,2-3H3 |
| InChIKey | MVMIDHSFEIDHQG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|