C24H31F3N2O3S — CID 23446661
N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 23446661) has the molecular formula C24H31F3N2O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23446661 |
| Molecular Formula | C24H31F3N2O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-methyl-N-[4-[6-[methyl(prop-2-enyl)amino]hexoxy]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(C)CCCCCCOc1ccc(N(C)S(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H31F3N2O3S/c1-4-17-28(2)18-7-5-6-8-19-32-22-13-11-21(12-14-22)29(3)33(30,31)23-15-9-20(10-16-23)24(25,26)27/h4,9-16H,1,5-8,17-19H2,2-3H3 |
| InChIKey | LLCWQCXRLPSPBZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|