C26H35F3N2O4S — CID 23446504
N-[4-[6-[4-(hydroxymethyl)piperidin-1-yl]hexoxy]phenyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 23446504) has the molecular formula C26H35F3N2O4S and a molecular weight of 528.64 g/mol. Its IUPAC name is N-[4-[6-[4-(hydroxymethyl)piperidin-1-yl]hexoxy]phenyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[6-[4-(hydroxymethyl)piperidin-1-yl]hexoxy]phenyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23446504 |
| Molecular Formula | C26H35F3N2O4S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N-[4-[6-[4-(hydroxymethyl)piperidin-1-yl]hexoxy]phenyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(c1ccc(OCCCCCCN2CCC(CO)CC2)cc1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H35F3N2O4S/c1-30(36(33,34)25-12-6-22(7-13-25)26(27,28)29)23-8-10-24(11-9-23)35-19-5-3-2-4-16-31-17-14-21(20-32)15-18-31/h6-13,21,32H,2-5,14-20H2,1H3 |
| InChIKey | NNJFGADVARDLFS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|