C24H31F3N2O4S — CID 23446712
N-methyl-N-[4-(6-morpholin-4-ylhexoxy)phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 23446712) has the molecular formula C24H31F3N2O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is N-methyl-N-[4-(6-morpholin-4-ylhexoxy)phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-methyl-N-[4-(6-morpholin-4-ylhexoxy)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23446712 |
| Molecular Formula | C24H31F3N2O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-methyl-N-[4-(6-morpholin-4-ylhexoxy)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(c1ccc(OCCCCCCN2CCOCC2)cc1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H31F3N2O4S/c1-28(34(30,31)23-12-6-20(7-13-23)24(25,26)27)21-8-10-22(11-9-21)33-17-5-3-2-4-14-29-15-18-32-19-16-29/h6-13H,2-5,14-19H2,1H3 |
| InChIKey | FTHCPPBLTZYGKX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|