C26H32N2O7S — CID 70037898
2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-2-[4-(2-morpholin-4-ylethoxy)phenyl]propanoic acid (PubChem CID 70037898) has the molecular formula C26H32N2O7S and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-2-[4-(2-morpholin-4-ylethoxy)phenyl]propanoic acid.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-2-[4-(2-morpholin-4-ylethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70037898 |
| Molecular Formula | C26H32N2O7S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonyl-methylamino]-2-[4-(2-morpholin-4-ylethoxy)phenyl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N(C)C(C)(C(=O)O)c2ccc(OCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O7S/c1-4-5-17-34-23-10-12-24(13-11-23)36(31,32)27(3)26(2,25(29)30)21-6-8-22(9-7-21)35-20-16-28-14-18-33-19-15-28/h6-13H,14-20H2,1-3H3,(H,29,30) |
| InChIKey | GCDNJCNAGTXFBI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|